C27H39NO2 — CID 70636301
(1R,4aR,4bS,10aR)-N-(3-methoxyphenyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,10,10a-decahydrophenanthrene-1-carboxamide (PubChem CID 70636301) has the molecular formula C27H39NO2 and a molecular weight of 409.61 g/mol. Its IUPAC name is (1R,4aR,4bS,10aR)-N-(3-methoxyphenyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,10,10a-decahydrophenanthrene-1-carboxamide.
| Compound Name | (1R,4aR,4bS,10aR)-N-(3-methoxyphenyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,10,10a-decahydrophenanthrene-1-carboxamide |
|---|---|
| PubChem CID | 70636301 |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | (1R,4aR,4bS,10aR)-N-(3-methoxyphenyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,10,10a-decahydrophenanthrene-1-carboxamide |
| SMILES | COc1cccc(NC(=O)[C@]2(C)CCC[C@@]3(C)[C@H]2CC=C2CC(C(C)C)CC[C@@H]23)c1 |
| InChI | InChI=1S/C27H39NO2/c1-18(2)19-10-12-23-20(16-19)11-13-24-26(23,3)14-7-15-27(24,4)25(29)28-21-8-6-9-22(17-21)30-5/h6,8-9,11,17-19,23-24H,7,10,12-16H2,1-5H3,(H,28,29)/t19?,23-,24+,26+,27+/m0/s1 |
| InChIKey | BLRVDESURZYIJN-XAUBHMMNSA-N |
| XLogP | 6.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|