C10H8N2O4 — CID 70639006
(1,3-dioxoisoindol-2-yl)-methylcarbamic acid (PubChem CID 70639006) has the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)-methylcarbamic acid.
| Compound Name | (1,3-dioxoisoindol-2-yl)-methylcarbamic acid |
|---|---|
| PubChem CID | 70639006 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)-methylcarbamic acid |
| SMILES | CN(C(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C10H8N2O4/c1-11(10(15)16)12-8(13)6-4-2-3-5-7(6)9(12)14/h2-5H,1H3,(H,15,16) |
| InChIKey | ZSNPYLOTAYGJKQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|