C17H16IN3O2S — CID 12768104
methyl N-(1,3-dioxoisoindol-2-yl)-N-methyl-N'-phenylcarbamimidothioate;hydroiodide (PubChem CID 12768104) has the molecular formula C17H16IN3O2S and a molecular weight of 453.31 g/mol. Its IUPAC name is methyl N-(1,3-dioxoisoindol-2-yl)-N-methyl-N'-phenylcarbamimidothioate;hydroiodide.
| Compound Name | methyl N-(1,3-dioxoisoindol-2-yl)-N-methyl-N'-phenylcarbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 12768104 |
| Molecular Formula | C17H16IN3O2S |
| Molecular Weight | 453.31 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | methyl N-(1,3-dioxoisoindol-2-yl)-N-methyl-N'-phenylcarbamimidothioate;hydroiodide |
| SMILES | CS/C(=N\c1ccccc1)N(C)N1C(=O)c2ccccc2C1=O.I |
| InChI | InChI=1S/C17H15N3O2S.HI/c1-19(17(23-2)18-12-8-4-3-5-9-12)20-15(21)13-10-6-7-11-14(13)16(20)22;/h3-11H,1-2H3;1H/b18-17-; |
| InChIKey | ZBDQDRHSJYGPSQ-YBFBCAGJSA-N |
| XLogP | 3.80 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|