C22H25N4O2S+ — CID 9422597
2-(1,3-dioxoisoindol-2-yl)ethyl 4-methyl-N-phenylpiperazin-4-ium-1-carboximidothioate (PubChem CID 9422597) has the molecular formula C22H25N4O2S+ and a molecular weight of 409.54 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 4-methyl-N-phenylpiperazin-4-ium-1-carboximidothioate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 4-methyl-N-phenylpiperazin-4-ium-1-carboximidothioate |
|---|---|
| PubChem CID | 9422597 |
| Molecular Formula | C22H25N4O2S+ |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 4-methyl-N-phenylpiperazin-4-ium-1-carboximidothioate |
| SMILES | C[NH+]1CCN(/C(=N\c2ccccc2)SCCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C22H24N4O2S/c1-24-11-13-25(14-12-24)22(23-17-7-3-2-4-8-17)29-16-15-26-20(27)18-9-5-6-10-19(18)21(26)28/h2-10H,11-16H2,1H3/p+1/b23-22+ |
| InChIKey | JZNOGHZFINMBOI-GHVJWSGMSA-O |
| XLogP | 1.53 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|