C22H27N3S — CID 14945087
2-pyrrolidin-1-ylethyl N-phenyl-3,4-dihydro-1H-isoquinoline-2-carboximidothioate (PubChem CID 14945087) has the molecular formula C22H27N3S and a molecular weight of 365.55 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylethyl N-phenyl-3,4-dihydro-1H-isoquinoline-2-carboximidothioate.
| Compound Name | 2-pyrrolidin-1-ylethyl N-phenyl-3,4-dihydro-1H-isoquinoline-2-carboximidothioate |
|---|---|
| PubChem CID | 14945087 |
| Molecular Formula | C22H27N3S |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-pyrrolidin-1-ylethyl N-phenyl-3,4-dihydro-1H-isoquinoline-2-carboximidothioate |
| SMILES | c1ccc(/N=C(\SCCN2CCCC2)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C22H27N3S/c1-2-10-21(11-3-1)23-22(26-17-16-24-13-6-7-14-24)25-15-12-19-8-4-5-9-20(19)18-25/h1-5,8-11H,6-7,12-18H2/b23-22- |
| InChIKey | XRALDKFJNLVMPF-FCQUAONHSA-N |
| XLogP | 4.56 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|