C29H41N5O2S3 — CID 166451349
[2-(ethylsulfonylamino)-3-(N-phenyl-C-piperidin-1-ylcarbonimidoyl)sulfanylpropyl] N-phenylpiperidine-1-carboximidothioate (PubChem CID 166451349) has the molecular formula C29H41N5O2S3 and a molecular weight of 587.88 g/mol. Its IUPAC name is [2-(ethylsulfonylamino)-3-(N-phenyl-C-piperidin-1-ylcarbonimidoyl)sulfanylpropyl] N-phenylpiperidine-1-carboximidothioate.
| Compound Name | [2-(ethylsulfonylamino)-3-(N-phenyl-C-piperidin-1-ylcarbonimidoyl)sulfanylpropyl] N-phenylpiperidine-1-carboximidothioate |
|---|---|
| PubChem CID | 166451349 |
| Molecular Formula | C29H41N5O2S3 |
| Molecular Weight | 587.88 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | [2-(ethylsulfonylamino)-3-(N-phenyl-C-piperidin-1-ylcarbonimidoyl)sulfanylpropyl] N-phenylpiperidine-1-carboximidothioate |
| SMILES | CCS(=O)(=O)NC(CS/C(=N\c1ccccc1)N1CCCCC1)CS/C(=N/c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C29H41N5O2S3/c1-2-39(35,36)32-27(23-37-28(33-19-11-5-12-20-33)30-25-15-7-3-8-16-25)24-38-29(34-21-13-6-14-22-34)31-26-17-9-4-10-18-26/h3-4,7-10,15-18,27,32H,2,5-6,11-14,19-24H2,1H3/b30-28-,31-29+ |
| InChIKey | ABNDELHFXWEUSC-OAZKENCHSA-N |
| XLogP | 6.11 |
| TPSA | 77.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.88 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|