C23H17Cl2N3O2S — CID 13102984
(2,6-dichlorophenyl)methyl N-(1,3-dioxoisoindol-2-yl)-N-methyl-N'-phenylcarbamimidothioate (PubChem CID 13102984) has the molecular formula C23H17Cl2N3O2S and a molecular weight of 470.38 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl N-(1,3-dioxoisoindol-2-yl)-N-methyl-N'-phenylcarbamimidothioate.
| Compound Name | (2,6-dichlorophenyl)methyl N-(1,3-dioxoisoindol-2-yl)-N-methyl-N'-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 13102984 |
| Molecular Formula | C23H17Cl2N3O2S |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | (2,6-dichlorophenyl)methyl N-(1,3-dioxoisoindol-2-yl)-N-methyl-N'-phenylcarbamimidothioate |
| SMILES | CN(/C(=N/c1ccccc1)SCc1c(Cl)cccc1Cl)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H17Cl2N3O2S/c1-27(28-21(29)16-10-5-6-11-17(16)22(28)30)23(26-15-8-3-2-4-9-15)31-14-18-19(24)12-7-13-20(18)25/h2-13H,14H2,1H3/b26-23- |
| InChIKey | QDEBCYDENWIWGR-RWEWTDSWSA-N |
| XLogP | 6.06 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|