C31H52O3 — CID 70643510
(14R)-3-methoxy-17-[(1E)-1-methoxy-5-methylhexa-1,4-dienyl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-12-ol (PubChem CID 70643510) has the molecular formula C31H52O3 and a molecular weight of 472.75 g/mol. Its IUPAC name is (14R)-3-methoxy-17-[(1E)-1-methoxy-5-methylhexa-1,4-dienyl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-12-ol.
| Compound Name | (14R)-3-methoxy-17-[(1E)-1-methoxy-5-methylhexa-1,4-dienyl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-12-ol |
|---|---|
| PubChem CID | 70643510 |
| Molecular Formula | C31H52O3 |
| Molecular Weight | 472.75 g/mol |
| Exact Mass | 472.39 |
| IUPAC Name | (14R)-3-methoxy-17-[(1E)-1-methoxy-5-methylhexa-1,4-dienyl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-12-ol |
| SMILES | CO/C(=C/CC=C(C)C)C1CC[C@]2(C)C1C(O)CC1C3(C)CCC(OC)C(C)(C)C3CCC12C |
| InChI | InChI=1S/C31H52O3/c1-20(2)11-10-12-23(33-8)21-13-17-31(7)27(21)22(32)19-25-29(5)16-15-26(34-9)28(3,4)24(29)14-18-30(25,31)6/h11-12,21-22,24-27,32H,10,13-19H2,1-9H3/b23-12+/t21?,22?,24?,25?,26?,27?,29?,30?,31-/m1/s1 |
| InChIKey | JBSHCGJUPSMWCT-FCBWTICISA-N |
| XLogP | 7.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.75 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|