C25H27Cl2NO5 — CID 70644660
2-[(3R,5R)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(1S,2R,3S)-2,3-dihydroxycyclopentyl]-3-methyl-2-oxopiperidin-3-yl]acetic acid (PubChem CID 70644660) has the molecular formula C25H27Cl2NO5 and a molecular weight of 492.40 g/mol. Its IUPAC name is 2-[(3R,5R)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(1S,2R,3S)-2,3-dihydroxycyclopentyl]-3-methyl-2-oxopiperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,5R)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(1S,2R,3S)-2,3-dihydroxycyclopentyl]-3-methyl-2-oxopiperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70644660 |
| Molecular Formula | C25H27Cl2NO5 |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 2-[(3R,5R)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(1S,2R,3S)-2,3-dihydroxycyclopentyl]-3-methyl-2-oxopiperidin-3-yl]acetic acid |
| SMILES | C[C@]1(CC(=O)O)C[C@H](c2cccc(Cl)c2)C(c2ccc(Cl)cc2)N([C@H]2CC[C@H](O)[C@@H]2O)C1=O |
| InChI | InChI=1S/C25H27Cl2NO5/c1-25(13-21(30)31)12-18(15-3-2-4-17(27)11-15)22(14-5-7-16(26)8-6-14)28(24(25)33)19-9-10-20(29)23(19)32/h2-8,11,18-20,22-23,29,32H,9-10,12-13H2,1H3,(H,30,31)/t18-,19+,20+,22?,23-,25-/m1/s1 |
| InChIKey | CPDLQUCIPXCTHZ-KFKQIDRLSA-N |
| XLogP | 4.42 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |