C25H25Cl2NO3 — CID 67999874
2-[(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-cyclopent-2-en-1-yl-3-methyl-2-oxopiperidin-3-yl]acetic acid (PubChem CID 67999874) has the molecular formula C25H25Cl2NO3 and a molecular weight of 458.39 g/mol. Its IUPAC name is 2-[(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-cyclopent-2-en-1-yl-3-methyl-2-oxopiperidin-3-yl]acetic acid.
| Compound Name | 2-[(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-cyclopent-2-en-1-yl-3-methyl-2-oxopiperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 67999874 |
| Molecular Formula | C25H25Cl2NO3 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-[(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-cyclopent-2-en-1-yl-3-methyl-2-oxopiperidin-3-yl]acetic acid |
| SMILES | C[C@@]1(CC(=O)O)C[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N(C2C=CCC2)C1=O |
| InChI | InChI=1S/C25H25Cl2NO3/c1-25(15-22(29)30)14-21(17-5-4-6-19(27)13-17)23(16-9-11-18(26)12-10-16)28(24(25)31)20-7-2-3-8-20/h2,4-7,9-13,20-21,23H,3,8,14-15H2,1H3,(H,29,30)/t20?,21-,23-,25+/m1/s1 |
| InChIKey | KLZRNGHXSXJFGI-IUBNBQIUSA-N |
| XLogP | 6.25 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|