C26H29Cl2NO3 — CID 76834467
5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-cyclopent-2-en-1-yl-3-(2,3-dihydroxypropyl)-3-methylpiperidin-2-one (PubChem CID 76834467) has the molecular formula C26H29Cl2NO3 and a molecular weight of 474.43 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-cyclopent-2-en-1-yl-3-(2,3-dihydroxypropyl)-3-methylpiperidin-2-one.
| Compound Name | 5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-cyclopent-2-en-1-yl-3-(2,3-dihydroxypropyl)-3-methylpiperidin-2-one |
|---|---|
| PubChem CID | 76834467 |
| Molecular Formula | C26H29Cl2NO3 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-cyclopent-2-en-1-yl-3-(2,3-dihydroxypropyl)-3-methylpiperidin-2-one |
| SMILES | CC1(CC(O)CO)CC(c2cccc(Cl)c2)C(c2ccc(Cl)cc2)N(C2C=CCC2)C1=O |
| InChI | InChI=1S/C26H29Cl2NO3/c1-26(14-22(31)16-30)15-23(18-5-4-6-20(28)13-18)24(17-9-11-19(27)12-10-17)29(25(26)32)21-7-2-3-8-21/h2,4-7,9-13,21-24,30-31H,3,8,14-16H2,1H3 |
| InChIKey | UFSHQOCLNRRYSB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|