C16H23F3 — CID 70646216
1-tert-butyl-3-[2-(trifluoromethyl)pentyl]benzene (PubChem CID 70646216) has the molecular formula C16H23F3 and a molecular weight of 272.35 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-(trifluoromethyl)pentyl]benzene.
| Compound Name | 1-tert-butyl-3-[2-(trifluoromethyl)pentyl]benzene |
|---|---|
| PubChem CID | 70646216 |
| Molecular Formula | C16H23F3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 1-tert-butyl-3-[2-(trifluoromethyl)pentyl]benzene |
| SMILES | CCCC(Cc1cccc(C(C)(C)C)c1)C(F)(F)F |
| InChI | InChI=1S/C16H23F3/c1-5-7-14(16(17,18)19)11-12-8-6-9-13(10-12)15(2,3)4/h6,8-10,14H,5,7,11H2,1-4H3 |
| InChIKey | LVLSBXORZBEFNM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |