C14H21N5O2 — CID 70653678
3-amino-N-[3-(6-ethyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)propyl]propanamide (PubChem CID 70653678) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 3-amino-N-[3-(6-ethyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)propyl]propanamide.
| Compound Name | 3-amino-N-[3-(6-ethyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)propyl]propanamide |
|---|---|
| PubChem CID | 70653678 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 3-amino-N-[3-(6-ethyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)propyl]propanamide |
| SMILES | CCc1cc2cn(CCCNC(=O)CCN)c(=O)nc2[nH]1 |
| InChI | InChI=1S/C14H21N5O2/c1-2-11-8-10-9-19(14(21)18-13(10)17-11)7-3-6-16-12(20)4-5-15/h8-9H,2-7,15H2,1H3,(H,16,20)(H,17,18,21) |
| InChIKey | AIQRCNKHPAWQKU-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|