C18H23N3O3 — CID 70653946
1-[4-(3,4-dimethoxyanilino)-2-pyridinyl]piperidin-4-ol (PubChem CID 70653946) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-[4-(3,4-dimethoxyanilino)-2-pyridinyl]piperidin-4-ol.
| Compound Name | 1-[4-(3,4-dimethoxyanilino)-2-pyridinyl]piperidin-4-ol |
|---|---|
| PubChem CID | 70653946 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-[4-(3,4-dimethoxyanilino)-2-pyridinyl]piperidin-4-ol |
| SMILES | COc1ccc(Nc2ccnc(N3CCC(O)CC3)c2)cc1OC |
| InChI | InChI=1S/C18H23N3O3/c1-23-16-4-3-13(11-17(16)24-2)20-14-5-8-19-18(12-14)21-9-6-15(22)7-10-21/h3-5,8,11-12,15,22H,6-7,9-10H2,1-2H3,(H,19,20) |
| InChIKey | NICCJOSEXHNTLC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |