C19H22F3N3O3 — CID 67171308
4-(hydroxymethyl)-1-[4-[4-methoxy-3-(trifluoromethyl)anilino]-2-pyridinyl]piperidin-4-ol (PubChem CID 67171308) has the molecular formula C19H22F3N3O3 and a molecular weight of 397.40 g/mol. Its IUPAC name is 4-(hydroxymethyl)-1-[4-[4-methoxy-3-(trifluoromethyl)anilino]-2-pyridinyl]piperidin-4-ol.
| Compound Name | 4-(hydroxymethyl)-1-[4-[4-methoxy-3-(trifluoromethyl)anilino]-2-pyridinyl]piperidin-4-ol |
|---|---|
| PubChem CID | 67171308 |
| Molecular Formula | C19H22F3N3O3 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 4-(hydroxymethyl)-1-[4-[4-methoxy-3-(trifluoromethyl)anilino]-2-pyridinyl]piperidin-4-ol |
| SMILES | COc1ccc(Nc2ccnc(N3CCC(O)(CO)CC3)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C19H22F3N3O3/c1-28-16-3-2-13(10-15(16)19(20,21)22)24-14-4-7-23-17(11-14)25-8-5-18(27,12-26)6-9-25/h2-4,7,10-11,26-27H,5-6,8-9,12H2,1H3,(H,23,24) |
| InChIKey | UZUDRLAFWQKNJL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |