C20H19N5O3S — CID 70654610
6-[2-amino-5-[4-(cyclopropylsulfamoyl)phenyl]-3-pyridinyl]pyridine-3-carboxamide (PubChem CID 70654610) has the molecular formula C20H19N5O3S and a molecular weight of 409.47 g/mol. Its IUPAC name is 6-[2-amino-5-[4-(cyclopropylsulfamoyl)phenyl]-3-pyridinyl]pyridine-3-carboxamide.
| Compound Name | 6-[2-amino-5-[4-(cyclopropylsulfamoyl)phenyl]-3-pyridinyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 70654610 |
| Molecular Formula | C20H19N5O3S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 6-[2-amino-5-[4-(cyclopropylsulfamoyl)phenyl]-3-pyridinyl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(-c2cc(-c3ccc(S(=O)(=O)NC4CC4)cc3)cnc2N)nc1 |
| InChI | InChI=1S/C20H19N5O3S/c21-19-17(18-8-3-13(10-23-18)20(22)26)9-14(11-24-19)12-1-6-16(7-2-12)29(27,28)25-15-4-5-15/h1-3,6-11,15,25H,4-5H2,(H2,21,24)(H2,22,26) |
| InChIKey | FZYYDMSFLREKOY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |