C17H18FN3O5S2 — CID 55902715
3-[[4-(cyclopropylsulfamoyl)phenyl]sulfonylamino]-5-fluoro-4-methylbenzamide (PubChem CID 55902715) has the molecular formula C17H18FN3O5S2 and a molecular weight of 427.48 g/mol. Its IUPAC name is 3-[[4-(cyclopropylsulfamoyl)phenyl]sulfonylamino]-5-fluoro-4-methylbenzamide.
| Compound Name | 3-[[4-(cyclopropylsulfamoyl)phenyl]sulfonylamino]-5-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 55902715 |
| Molecular Formula | C17H18FN3O5S2 |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 3-[[4-(cyclopropylsulfamoyl)phenyl]sulfonylamino]-5-fluoro-4-methylbenzamide |
| SMILES | Cc1c(F)cc(C(N)=O)cc1NS(=O)(=O)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C17H18FN3O5S2/c1-10-15(18)8-11(17(19)22)9-16(10)21-28(25,26)14-6-4-13(5-7-14)27(23,24)20-12-2-3-12/h4-9,12,20-21H,2-3H2,1H3,(H2,19,22) |
| InChIKey | QVNRHVYBGGFSGA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |