C17H24F3N2O+ — CID 7065674
3-methyl-1-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-4-ium-1-yl]butan-1-one (PubChem CID 7065674) has the molecular formula C17H24F3N2O+ and a molecular weight of 329.39 g/mol. Its IUPAC name is 3-methyl-1-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-4-ium-1-yl]butan-1-one.
| Compound Name | 3-methyl-1-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-4-ium-1-yl]butan-1-one |
|---|---|
| PubChem CID | 7065674 |
| Molecular Formula | C17H24F3N2O+ |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 3-methyl-1-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-4-ium-1-yl]butan-1-one |
| SMILES | CC(C)CC(=O)N1CC[NH+](Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H23F3N2O/c1-13(2)10-16(23)22-8-6-21(7-9-22)12-14-4-3-5-15(11-14)17(18,19)20/h3-5,11,13H,6-10,12H2,1-2H3/p+1 |
| InChIKey | BEDSRXCWDSULLG-UHFFFAOYSA-O |
| XLogP | 1.98 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |