C18H26F3N3O — CID 120872790
3-amino-1-[4-[methyl-[[3-(trifluoromethyl)phenyl]methyl]amino]piperidin-1-yl]butan-1-one (PubChem CID 120872790) has the molecular formula C18H26F3N3O and a molecular weight of 357.42 g/mol. Its IUPAC name is 3-amino-1-[4-[methyl-[[3-(trifluoromethyl)phenyl]methyl]amino]piperidin-1-yl]butan-1-one.
| Compound Name | 3-amino-1-[4-[methyl-[[3-(trifluoromethyl)phenyl]methyl]amino]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 120872790 |
| Molecular Formula | C18H26F3N3O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 3-amino-1-[4-[methyl-[[3-(trifluoromethyl)phenyl]methyl]amino]piperidin-1-yl]butan-1-one |
| SMILES | CC(N)CC(=O)N1CCC(N(C)Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H26F3N3O/c1-13(22)10-17(25)24-8-6-16(7-9-24)23(2)12-14-4-3-5-15(11-14)18(19,20)21/h3-5,11,13,16H,6-10,12,22H2,1-2H3 |
| InChIKey | DSDGKVWJWFADRU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |