C13H16O2 — CID 70660537
(2S)-2-(2-but-1-ynylphenoxy)propan-1-ol (PubChem CID 70660537) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (2S)-2-(2-but-1-ynylphenoxy)propan-1-ol.
| Compound Name | (2S)-2-(2-but-1-ynylphenoxy)propan-1-ol |
|---|---|
| PubChem CID | 70660537 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (2S)-2-(2-but-1-ynylphenoxy)propan-1-ol |
| SMILES | CCC#Cc1ccccc1O[C@@H](C)CO |
| InChI | InChI=1S/C13H16O2/c1-3-4-7-12-8-5-6-9-13(12)15-11(2)10-14/h5-6,8-9,11,14H,3,10H2,1-2H3/t11-/m0/s1 |
| InChIKey | SHBNKUQKRNWWGK-NSHDSACASA-N |
| XLogP | 2.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|