C17H23NO2 — CID 70660969
3-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-N,N-dimethylbenzamide (PubChem CID 70660969) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-N,N-dimethylbenzamide.
| Compound Name | 3-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 70660969 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 3-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(OC2C[C@H]3CC[C@@H](C2)C3)c1 |
| InChI | InChI=1S/C17H23NO2/c1-18(2)17(19)14-4-3-5-15(11-14)20-16-9-12-6-7-13(8-12)10-16/h3-5,11-13,16H,6-10H2,1-2H3/t12-,13+,16? |
| InChIKey | STVYVOMQMCICQA-OCZCAGDBSA-N |
| XLogP | 3.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |