C9H10F3NO2 — CID 70661167
2-methoxy-4-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyridine (PubChem CID 70661167) has the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. Its IUPAC name is 2-methoxy-4-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyridine.
| Compound Name | 2-methoxy-4-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyridine |
|---|---|
| PubChem CID | 70661167 |
| Molecular Formula | C9H10F3NO2 |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-methoxy-4-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyridine |
| SMILES | COc1cc(O[C@H](C)C(F)(F)F)ccn1 |
| InChI | InChI=1S/C9H10F3NO2/c1-6(9(10,11)12)15-7-3-4-13-8(5-7)14-2/h3-6H,1-2H3/t6-/m1/s1 |
| InChIKey | MDLXYXAPVVHDEN-ZCFIWIBFSA-N |
| XLogP | 2.42 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |