C27H24FN3O2 — CID 70661278
benzyl 2-(4-fluorophenyl)-3-[(2S)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylate (PubChem CID 70661278) has the molecular formula C27H24FN3O2 and a molecular weight of 441.51 g/mol. Its IUPAC name is benzyl 2-(4-fluorophenyl)-3-[(2S)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylate.
| Compound Name | benzyl 2-(4-fluorophenyl)-3-[(2S)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 70661278 |
| Molecular Formula | C27H24FN3O2 |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | benzyl 2-(4-fluorophenyl)-3-[(2S)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylate |
| SMILES | C[C@H]1CCCN1c1nc2cc(C(=O)OCc3ccccc3)ccc2nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H24FN3O2/c1-18-6-5-15-31(18)26-25(20-9-12-22(28)13-10-20)29-23-14-11-21(16-24(23)30-26)27(32)33-17-19-7-3-2-4-8-19/h2-4,7-14,16,18H,5-6,15,17H2,1H3/t18-/m0/s1 |
| InChIKey | LUHXEGALAXVXLB-SFHVURJKSA-N |
| XLogP | 5.78 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |