C21H21N3O3 — CID 67042109
methyl 3-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-phenylquinoxaline-6-carboxylate (PubChem CID 67042109) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is methyl 3-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-phenylquinoxaline-6-carboxylate.
| Compound Name | methyl 3-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-phenylquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 67042109 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | methyl 3-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-phenylquinoxaline-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(-c3ccccc3)c(N3CCCC3CO)nc2c1 |
| InChI | InChI=1S/C21H21N3O3/c1-27-21(26)15-9-10-17-18(12-15)23-20(24-11-5-8-16(24)13-25)19(22-17)14-6-3-2-4-7-14/h2-4,6-7,9-10,12,16,25H,5,8,11,13H2,1H3 |
| InChIKey | KOLJFQBDGOMZKV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |