C18H24INO3 — CID 70661604
tert-butyl (1R,5S)-3-(3-iodophenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 70661604) has the molecular formula C18H24INO3 and a molecular weight of 429.30 g/mol. Its IUPAC name is tert-butyl (1R,5S)-3-(3-iodophenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl (1R,5S)-3-(3-iodophenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 70661604 |
| Molecular Formula | C18H24INO3 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | tert-butyl (1R,5S)-3-(3-iodophenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CC(Oc1cccc(I)c1)C2 |
| InChI | InChI=1S/C18H24INO3/c1-18(2,3)23-17(21)20-13-7-8-14(20)11-16(10-13)22-15-6-4-5-12(19)9-15/h4-6,9,13-14,16H,7-8,10-11H2,1-3H3/t13-,14+,16? |
| InChIKey | ZBTYUAXIYDABDZ-MZBDJJRSSA-N |
| XLogP | 4.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|