C20H28N2O5 — CID 88908984
tert-butyl (1S,5R)-3-[3-(methoxycarbamoyl)phenoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 88908984) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is tert-butyl (1S,5R)-3-[3-(methoxycarbamoyl)phenoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl (1S,5R)-3-[3-(methoxycarbamoyl)phenoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 88908984 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | tert-butyl (1S,5R)-3-[3-(methoxycarbamoyl)phenoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CONC(=O)c1cccc(OC2C[C@H]3CC[C@@H](C2)N3C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C20H28N2O5/c1-20(2,3)27-19(24)22-14-8-9-15(22)12-17(11-14)26-16-7-5-6-13(10-16)18(23)21-25-4/h5-7,10,14-15,17H,8-9,11-12H2,1-4H3,(H,21,23)/t14-,15+,17? |
| InChIKey | OKAXVNGTOIVMDJ-FKEKPDDDSA-N |
| XLogP | 3.29 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|