C18H17FN2O3 — CID 7066371
[(2S,4R)-5-(4-fluorophenyl)-3-hydroxy-2,4-dimethyl-1-oxido-4H-imidazol-1-ium-2-yl]-phenylmethanone (PubChem CID 7066371) has the molecular formula C18H17FN2O3 and a molecular weight of 328.34 g/mol. Its IUPAC name is [(2S,4R)-5-(4-fluorophenyl)-3-hydroxy-2,4-dimethyl-1-oxido-4H-imidazol-1-ium-2-yl]-phenylmethanone.
| Compound Name | [(2S,4R)-5-(4-fluorophenyl)-3-hydroxy-2,4-dimethyl-1-oxido-4H-imidazol-1-ium-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 7066371 |
| Molecular Formula | C18H17FN2O3 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | [(2S,4R)-5-(4-fluorophenyl)-3-hydroxy-2,4-dimethyl-1-oxido-4H-imidazol-1-ium-2-yl]-phenylmethanone |
| SMILES | C[C@@H]1C(c2ccc(F)cc2)=[N+]([O-])[C@@](C)(C(=O)c2ccccc2)N1O |
| InChI | InChI=1S/C18H17FN2O3/c1-12-16(13-8-10-15(19)11-9-13)21(24)18(2,20(12)23)17(22)14-6-4-3-5-7-14/h3-12,23H,1-2H3/t12-,18+/m1/s1 |
| InChIKey | FYCWPWVYFWSEQI-XIKOKIGWSA-N |
| XLogP | 2.82 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|