C16H17FN2O — CID 91521284
1-[2-(4-fluorophenyl)-6-methyl-3,5,6,8a-tetrahydroimidazo[1,2-a]pyridin-3-yl]ethanone (PubChem CID 91521284) has the molecular formula C16H17FN2O and a molecular weight of 272.32 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-6-methyl-3,5,6,8a-tetrahydroimidazo[1,2-a]pyridin-3-yl]ethanone.
| Compound Name | 1-[2-(4-fluorophenyl)-6-methyl-3,5,6,8a-tetrahydroimidazo[1,2-a]pyridin-3-yl]ethanone |
|---|---|
| PubChem CID | 91521284 |
| Molecular Formula | C16H17FN2O |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-6-methyl-3,5,6,8a-tetrahydroimidazo[1,2-a]pyridin-3-yl]ethanone |
| SMILES | CC(=O)C1C(c2ccc(F)cc2)=NC2C=CC(C)CN21 |
| InChI | InChI=1S/C16H17FN2O/c1-10-3-8-14-18-15(12-4-6-13(17)7-5-12)16(11(2)20)19(14)9-10/h3-8,10,14,16H,9H2,1-2H3 |
| InChIKey | KNQOYKDPPJURIJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|