C8H12N2O2S — CID 70669442
N-(2-methoxyethyl)-5-methyl-1,3-thiazole-2-carboxamide (PubChem CID 70669442) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-methyl-1,3-thiazole-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-5-methyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 70669442 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | N-(2-methoxyethyl)-5-methyl-1,3-thiazole-2-carboxamide |
| SMILES | COCCNC(=O)c1ncc(C)s1 |
| InChI | InChI=1S/C8H12N2O2S/c1-6-5-10-8(13-6)7(11)9-3-4-12-2/h5H,3-4H2,1-2H3,(H,9,11) |
| InChIKey | ADRBASDKIWGBDI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|