C14H16N3OS2+ — CID 7067067
3-(furan-2-ylmethyl)-5-(pyridin-2-ylmethyl)-1,3,5-thiadiazinan-5-ium-2-thione (PubChem CID 7067067) has the molecular formula C14H16N3OS2+ and a molecular weight of 306.44 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-5-(pyridin-2-ylmethyl)-1,3,5-thiadiazinan-5-ium-2-thione.
| Compound Name | 3-(furan-2-ylmethyl)-5-(pyridin-2-ylmethyl)-1,3,5-thiadiazinan-5-ium-2-thione |
|---|---|
| PubChem CID | 7067067 |
| Molecular Formula | C14H16N3OS2+ |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 3-(furan-2-ylmethyl)-5-(pyridin-2-ylmethyl)-1,3,5-thiadiazinan-5-ium-2-thione |
| SMILES | S=C1SC[NH+](Cc2ccccn2)CN1Cc1ccco1 |
| InChI | InChI=1S/C14H15N3OS2/c19-14-17(9-13-5-3-7-18-13)10-16(11-20-14)8-12-4-1-2-6-15-12/h1-7H,8-11H2/p+1 |
| InChIKey | DDINDQCBKGHLFJ-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 33.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|