C19H26FN3O4 — CID 70671899
3-(fluoromethoxy)-N-[2-[[(3R)-1-(oxan-4-yl)pyrrolidin-3-yl]amino]-2-oxoethyl]benzamide (PubChem CID 70671899) has the molecular formula C19H26FN3O4 and a molecular weight of 379.43 g/mol. Its IUPAC name is 3-(fluoromethoxy)-N-[2-[[(3R)-1-(oxan-4-yl)pyrrolidin-3-yl]amino]-2-oxoethyl]benzamide.
| Compound Name | 3-(fluoromethoxy)-N-[2-[[(3R)-1-(oxan-4-yl)pyrrolidin-3-yl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 70671899 |
| Molecular Formula | C19H26FN3O4 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 3-(fluoromethoxy)-N-[2-[[(3R)-1-(oxan-4-yl)pyrrolidin-3-yl]amino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(OCF)c1)N[C@@H]1CCN(C2CCOCC2)C1 |
| InChI | InChI=1S/C19H26FN3O4/c20-13-27-17-3-1-2-14(10-17)19(25)21-11-18(24)22-15-4-7-23(12-15)16-5-8-26-9-6-16/h1-3,10,15-16H,4-9,11-13H2,(H,21,25)(H,22,24)/t15-/m1/s1 |
| InChIKey | NTXCLMIWCKTQDZ-OAHLLOKOSA-N |
| XLogP | 1.09 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |