C16H22FNO4 — CID 70673966
(3aR,6R,7R,7aS)-4-[2-(4-fluorophenyl)ethyl]-2-methyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-2,6,7-triol (PubChem CID 70673966) has the molecular formula C16H22FNO4 and a molecular weight of 311.35 g/mol. Its IUPAC name is (3aR,6R,7R,7aS)-4-[2-(4-fluorophenyl)ethyl]-2-methyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-2,6,7-triol.
| Compound Name | (3aR,6R,7R,7aS)-4-[2-(4-fluorophenyl)ethyl]-2-methyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-2,6,7-triol |
|---|---|
| PubChem CID | 70673966 |
| Molecular Formula | C16H22FNO4 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (3aR,6R,7R,7aS)-4-[2-(4-fluorophenyl)ethyl]-2-methyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-2,6,7-triol |
| SMILES | CC1(O)C[C@@H]2[C@H](O1)[C@H](O)[C@H](O)CN2CCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H22FNO4/c1-16(21)8-12-15(22-16)14(20)13(19)9-18(12)7-6-10-2-4-11(17)5-3-10/h2-5,12-15,19-21H,6-9H2,1H3/t12-,13-,14-,15+,16?/m1/s1 |
| InChIKey | NCUKFRFVJUHWFG-YFVFXCHESA-N |
| XLogP | 0.27 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |