C17H19N5O2 — CID 70676084
4-[6-(2-methoxyethoxy)pteridin-4-yl]-N,N-dimethylaniline (PubChem CID 70676084) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 4-[6-(2-methoxyethoxy)pteridin-4-yl]-N,N-dimethylaniline.
| Compound Name | 4-[6-(2-methoxyethoxy)pteridin-4-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 70676084 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 4-[6-(2-methoxyethoxy)pteridin-4-yl]-N,N-dimethylaniline |
| SMILES | COCCOc1cnc2ncnc(-c3ccc(N(C)C)cc3)c2n1 |
| InChI | InChI=1S/C17H19N5O2/c1-22(2)13-6-4-12(5-7-13)15-16-17(20-11-19-15)18-10-14(21-16)24-9-8-23-3/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | RPYFFUOHZUKCSW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 73.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|