C27H29NOSi — CID 70678197
N-[(4-methylphenyl)-naphthalen-1-ylmethyl]-N-trimethylsilyloxyaniline (PubChem CID 70678197) has the molecular formula C27H29NOSi and a molecular weight of 411.62 g/mol. Its IUPAC name is N-[(4-methylphenyl)-naphthalen-1-ylmethyl]-N-trimethylsilyloxyaniline.
| Compound Name | N-[(4-methylphenyl)-naphthalen-1-ylmethyl]-N-trimethylsilyloxyaniline |
|---|---|
| PubChem CID | 70678197 |
| Molecular Formula | C27H29NOSi |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | N-[(4-methylphenyl)-naphthalen-1-ylmethyl]-N-trimethylsilyloxyaniline |
| SMILES | Cc1ccc(C(c2cccc3ccccc23)N(O[Si](C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29NOSi/c1-21-17-19-23(20-18-21)27(26-16-10-12-22-11-8-9-15-25(22)26)28(29-30(2,3)4)24-13-6-5-7-14-24/h5-20,27H,1-4H3 |
| InChIKey | LJWYISZZGNQLGX-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|