C39H40N6O4Si — CID 70678527
4-[[4-[(4-aminopyrimidin-2-yl)oxymethyl]phenyl]methylcarbamoyl]-2-[7-(dimethylamino)-3-dimethylazaniumylidene-5,5-dimethylbenzo[b][1]benzosilin-10-yl]benzoate (PubChem CID 70678527) has the molecular formula C39H40N6O4Si and a molecular weight of 684.87 g/mol. Its IUPAC name is 4-[[4-[(4-aminopyrimidin-2-yl)oxymethyl]phenyl]methylcarbamoyl]-2-[7-(dimethylamino)-3-dimethylazaniumylidene-5,5-dimethylbenzo[b][1]benzosilin-10-yl]benzoate.
| Compound Name | 4-[[4-[(4-aminopyrimidin-2-yl)oxymethyl]phenyl]methylcarbamoyl]-2-[7-(dimethylamino)-3-dimethylazaniumylidene-5,5-dimethylbenzo[b][1]benzosilin-10-yl]benzoate |
|---|---|
| PubChem CID | 70678527 |
| Molecular Formula | C39H40N6O4Si |
| Molecular Weight | 684.87 g/mol |
| Exact Mass | 684.29 |
| IUPAC Name | 4-[[4-[(4-aminopyrimidin-2-yl)oxymethyl]phenyl]methylcarbamoyl]-2-[7-(dimethylamino)-3-dimethylazaniumylidene-5,5-dimethylbenzo[b][1]benzosilin-10-yl]benzoate |
| SMILES | CN(C)c1ccc2c(c1)[Si](C)(C)C1=CC(=[N+](C)C)C=CC1=C2c1cc(C(=O)NCc2ccc(COc3nccc(N)n3)cc2)ccc1C(=O)[O-] |
| InChI | InChI=1S/C39H40N6O4Si/c1-44(2)27-12-15-30-33(20-27)50(5,6)34-21-28(45(3)4)13-16-31(34)36(30)32-19-26(11-14-29(32)38(47)48)37(46)42-22-24-7-9-25(10-8-24)23-49-39-41-18-17-35(40)43-39/h7-21H,22-23H2,1-6H3,(H3-,40,41,42,43,46,47,48) |
| InChIKey | SFODESMKOQOSAM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.87 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|