C25H30FNO4 — CID 70680151
3-[(3aS,5aS,6R,9aS,9bS)-3a,6-dimethyl-3,5,7-trioxo-1,2,4,5a,8,9,9a,9b-octahydrocyclopenta[a]naphthalen-6-yl]-N-[(3-fluorophenyl)methyl]propanamide (PubChem CID 70680151) has the molecular formula C25H30FNO4 and a molecular weight of 427.52 g/mol. Its IUPAC name is 3-[(3aS,5aS,6R,9aS,9bS)-3a,6-dimethyl-3,5,7-trioxo-1,2,4,5a,8,9,9a,9b-octahydrocyclopenta[a]naphthalen-6-yl]-N-[(3-fluorophenyl)methyl]propanamide.
| Compound Name | 3-[(3aS,5aS,6R,9aS,9bS)-3a,6-dimethyl-3,5,7-trioxo-1,2,4,5a,8,9,9a,9b-octahydrocyclopenta[a]naphthalen-6-yl]-N-[(3-fluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 70680151 |
| Molecular Formula | C25H30FNO4 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 3-[(3aS,5aS,6R,9aS,9bS)-3a,6-dimethyl-3,5,7-trioxo-1,2,4,5a,8,9,9a,9b-octahydrocyclopenta[a]naphthalen-6-yl]-N-[(3-fluorophenyl)methyl]propanamide |
| SMILES | C[C@]1(CCC(=O)NCc2cccc(F)c2)C(=O)CC[C@@H]2[C@@H]1C(=O)C[C@]1(C)C(=O)CC[C@@H]21 |
| InChI | InChI=1S/C25H30FNO4/c1-24(11-10-22(31)27-14-15-4-3-5-16(26)12-15)20(29)8-6-17-18-7-9-21(30)25(18,2)13-19(28)23(17)24/h3-5,12,17-18,23H,6-11,13-14H2,1-2H3,(H,27,31)/t17-,18-,23+,24-,25-/m0/s1 |
| InChIKey | MMIIRJHBXXGYLS-DUENCVSESA-N |
| XLogP | 3.78 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |