C18H23N2OS+ — CID 70680221
1-adamantyl-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]azanium (PubChem CID 70680221) has the molecular formula C18H23N2OS+ and a molecular weight of 315.46 g/mol. Its IUPAC name is 1-adamantyl-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]azanium.
| Compound Name | 1-adamantyl-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]azanium |
|---|---|
| PubChem CID | 70680221 |
| Molecular Formula | C18H23N2OS+ |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-adamantyl-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]azanium |
| SMILES | c1csc(-c2cc(C[NH2+]C34CC5CC(CC(C5)C3)C4)no2)c1 |
| InChI | InChI=1S/C18H22N2OS/c1-2-17(22-3-1)16-7-15(20-21-16)11-19-18-8-12-4-13(9-18)6-14(5-12)10-18/h1-3,7,12-14,19H,4-6,8-11H2/p+1 |
| InChIKey | PBZWFIHUWUZQDJ-UHFFFAOYSA-O |
| XLogP | 3.44 |
| TPSA | 42.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |