C18H22N2O2S — CID 127026871
5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-ol (PubChem CID 127026871) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is 5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-ol.
| Compound Name | 5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-ol |
|---|---|
| PubChem CID | 127026871 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-ol |
| SMILES | OC1C2CC3CC1CC(NCc1cc(-c4cccs4)on1)(C3)C2 |
| InChI | InChI=1S/C18H22N2O2S/c21-17-12-4-11-5-13(17)9-18(7-11,8-12)19-10-14-6-15(22-20-14)16-2-1-3-23-16/h1-3,6,11-13,17,19,21H,4-5,7-10H2 |
| InChIKey | ZDXODBZQBOCZBE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |