C20H16Cl2FN3O4 — CID 70681074
8-chloro-2-(4-chloro-2-fluoroanilino)-3-(3-methylbutanoyl)-5-nitro-1H-quinolin-4-one (PubChem CID 70681074) has the molecular formula C20H16Cl2FN3O4 and a molecular weight of 452.27 g/mol. Its IUPAC name is 8-chloro-2-(4-chloro-2-fluoroanilino)-3-(3-methylbutanoyl)-5-nitro-1H-quinolin-4-one.
| Compound Name | 8-chloro-2-(4-chloro-2-fluoroanilino)-3-(3-methylbutanoyl)-5-nitro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 70681074 |
| Molecular Formula | C20H16Cl2FN3O4 |
| Molecular Weight | 452.27 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | 8-chloro-2-(4-chloro-2-fluoroanilino)-3-(3-methylbutanoyl)-5-nitro-1H-quinolin-4-one |
| SMILES | CC(C)CC(=O)c1c(Nc2ccc(Cl)cc2F)[nH]c2c(Cl)ccc([N+](=O)[O-])c2c1=O |
| InChI | InChI=1S/C20H16Cl2FN3O4/c1-9(2)7-15(27)17-19(28)16-14(26(29)30)6-4-11(22)18(16)25-20(17)24-13-5-3-10(21)8-12(13)23/h3-6,8-9H,7H2,1-2H3,(H2,24,25,28) |
| InChIKey | HQFCKQLIQSYTSC-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 105.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.27 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|