C18H15FN2O4 — CID 70681536
8-fluoro-3-hydroxy-N-[(4-methoxyphenyl)methyl]-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 70681536) has the molecular formula C18H15FN2O4 and a molecular weight of 342.33 g/mol. Its IUPAC name is 8-fluoro-3-hydroxy-N-[(4-methoxyphenyl)methyl]-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | 8-fluoro-3-hydroxy-N-[(4-methoxyphenyl)methyl]-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 70681536 |
| Molecular Formula | C18H15FN2O4 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 8-fluoro-3-hydroxy-N-[(4-methoxyphenyl)methyl]-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2c(O)c(=O)[nH]c3c(F)cccc23)cc1 |
| InChI | InChI=1S/C18H15FN2O4/c1-25-11-7-5-10(6-8-11)9-20-17(23)14-12-3-2-4-13(19)15(12)21-18(24)16(14)22/h2-8,22H,9H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | FTMIARBQYFAZBS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |