C25H30O8 — CID 70682623
[(2S,3R,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl] 2-methyl-2-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]propanoate (PubChem CID 70682623) has the molecular formula C25H30O8 and a molecular weight of 458.51 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl] 2-methyl-2-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]propanoate.
| Compound Name | [(2S,3R,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl] 2-methyl-2-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]propanoate |
|---|---|
| PubChem CID | 70682623 |
| Molecular Formula | C25H30O8 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | [(2S,3R,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl] 2-methyl-2-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]propanoate |
| SMILES | CC(C)(Oc1ccc(C2CCCc3ccccc32)cc1)C(=O)O[C@@H]1O[C@H](O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H30O8/c1-25(2,24(30)32-23-21(28)19(26)20(27)22(29)31-23)33-16-12-10-15(11-13-16)18-9-5-7-14-6-3-4-8-17(14)18/h3-4,6,8,10-13,18-23,26-29H,5,7,9H2,1-2H3/t18?,19-,20-,21+,22-,23-/m0/s1 |
| InChIKey | KWMAHNPHVSDAGH-RWCPEOFKSA-N |
| XLogP | 1.61 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |