C20H29F2NO3 — CID 70683993
(1S,2R,4R,11S,12R)-12-[(4,4-difluoropiperidin-1-yl)methyl]-4,8-dimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one (PubChem CID 70683993) has the molecular formula C20H29F2NO3 and a molecular weight of 369.45 g/mol. Its IUPAC name is (1S,2R,4R,11S,12R)-12-[(4,4-difluoropiperidin-1-yl)methyl]-4,8-dimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one.
| Compound Name | (1S,2R,4R,11S,12R)-12-[(4,4-difluoropiperidin-1-yl)methyl]-4,8-dimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
|---|---|
| PubChem CID | 70683993 |
| Molecular Formula | C20H29F2NO3 |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (1S,2R,4R,11S,12R)-12-[(4,4-difluoropiperidin-1-yl)methyl]-4,8-dimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
| SMILES | CC1=CCC[C@@]2(C)O[C@@H]2[C@H]2OC(=O)[C@@H](CN3CCC(F)(F)CC3)[C@@H]2CC1 |
| InChI | InChI=1S/C20H29F2NO3/c1-13-4-3-7-19(2)17(26-19)16-14(6-5-13)15(18(24)25-16)12-23-10-8-20(21,22)9-11-23/h4,14-17H,3,5-12H2,1-2H3/t14-,15-,16-,17+,19+/m0/s1 |
| InChIKey | ATSLHGYWHBNEOX-YTGMWSOZSA-N |
| XLogP | 3.55 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|