C21H30F3NO3 — CID 70686120
(1S,2R,4R,11S,12R)-4,8-dimethyl-12-[[3-(trifluoromethyl)piperidin-1-yl]methyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one (PubChem CID 70686120) has the molecular formula C21H30F3NO3 and a molecular weight of 401.47 g/mol. Its IUPAC name is (1S,2R,4R,11S,12R)-4,8-dimethyl-12-[[3-(trifluoromethyl)piperidin-1-yl]methyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one.
| Compound Name | (1S,2R,4R,11S,12R)-4,8-dimethyl-12-[[3-(trifluoromethyl)piperidin-1-yl]methyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
|---|---|
| PubChem CID | 70686120 |
| Molecular Formula | C21H30F3NO3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | (1S,2R,4R,11S,12R)-4,8-dimethyl-12-[[3-(trifluoromethyl)piperidin-1-yl]methyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
| SMILES | CC1=CCC[C@@]2(C)O[C@@H]2[C@H]2OC(=O)[C@@H](CN3CCCC(C(F)(F)F)C3)[C@@H]2CC1 |
| InChI | InChI=1S/C21H30F3NO3/c1-13-5-3-9-20(2)18(28-20)17-15(8-7-13)16(19(26)27-17)12-25-10-4-6-14(11-25)21(22,23)24/h5,14-18H,3-4,6-12H2,1-2H3/t14?,15-,16-,17-,18+,20+/m0/s1 |
| InChIKey | ATIUOFKXXHOPLM-YDJXTUAISA-N |
| XLogP | 4.10 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|