C22H16ClN5O4 — CID 70684441
1-[[1-[2-(5-chloro-2,3-dioxoindol-1-yl)ethyl]triazol-4-yl]methyl]-5-methylindole-2,3-dione (PubChem CID 70684441) has the molecular formula C22H16ClN5O4 and a molecular weight of 449.85 g/mol. Its IUPAC name is 1-[[1-[2-(5-chloro-2,3-dioxoindol-1-yl)ethyl]triazol-4-yl]methyl]-5-methylindole-2,3-dione.
| Compound Name | 1-[[1-[2-(5-chloro-2,3-dioxoindol-1-yl)ethyl]triazol-4-yl]methyl]-5-methylindole-2,3-dione |
|---|---|
| PubChem CID | 70684441 |
| Molecular Formula | C22H16ClN5O4 |
| Molecular Weight | 449.85 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 1-[[1-[2-(5-chloro-2,3-dioxoindol-1-yl)ethyl]triazol-4-yl]methyl]-5-methylindole-2,3-dione |
| SMILES | Cc1ccc2c(c1)C(=O)C(=O)N2Cc1cn(CCN2C(=O)C(=O)c3cc(Cl)ccc32)nn1 |
| InChI | InChI=1S/C22H16ClN5O4/c1-12-2-4-18-15(8-12)19(29)22(32)28(18)11-14-10-26(25-24-14)6-7-27-17-5-3-13(23)9-16(17)20(30)21(27)31/h2-5,8-10H,6-7,11H2,1H3 |
| InChIKey | AEOIWFDGWWKUCZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 105.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.85 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|