C21H13ClFN5O4 — CID 70686581
1-[2-[4-[(5-chloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]ethyl]-5-fluoroindole-2,3-dione (PubChem CID 70686581) has the molecular formula C21H13ClFN5O4 and a molecular weight of 453.82 g/mol. Its IUPAC name is 1-[2-[4-[(5-chloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]ethyl]-5-fluoroindole-2,3-dione.
| Compound Name | 1-[2-[4-[(5-chloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]ethyl]-5-fluoroindole-2,3-dione |
|---|---|
| PubChem CID | 70686581 |
| Molecular Formula | C21H13ClFN5O4 |
| Molecular Weight | 453.82 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 1-[2-[4-[(5-chloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]ethyl]-5-fluoroindole-2,3-dione |
| SMILES | O=C1C(=O)N(CCn2cc(CN3C(=O)C(=O)c4cc(Cl)ccc43)nn2)c2ccc(F)cc21 |
| InChI | InChI=1S/C21H13ClFN5O4/c22-11-1-3-17-14(7-11)18(29)21(32)28(17)10-13-9-26(25-24-13)5-6-27-16-4-2-12(23)8-15(16)19(30)20(27)31/h1-4,7-9H,5-6,10H2 |
| InChIKey | MGHSRNRQNWAVNU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 105.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.82 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|