C18H21N4O3+ — CID 7068514
6-hydroxy-1-propyl-5-[(1R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]pyrimidine-2,4-dione (PubChem CID 7068514) has the molecular formula C18H21N4O3+ and a molecular weight of 341.39 g/mol. Its IUPAC name is 6-hydroxy-1-propyl-5-[(1R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1-propyl-5-[(1R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 7068514 |
| Molecular Formula | C18H21N4O3+ |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 6-hydroxy-1-propyl-5-[(1R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]pyrimidine-2,4-dione |
| SMILES | CCCn1c(O)c([C@H]2[NH2+]CCc3c2[nH]c2ccccc32)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H20N4O3/c1-2-9-22-17(24)13(16(23)21-18(22)25)15-14-11(7-8-19-15)10-5-3-4-6-12(10)20-14/h3-6,15,19-20,24H,2,7-9H2,1H3,(H,21,23,25)/p+1/t15-/m1/s1 |
| InChIKey | TUDVOALMTJUCBZ-OAHLLOKOSA-O |
| XLogP | 0.34 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|