C20H25N4O3+ — CID 7068480
1-butyl-6-hydroxy-5-[(1R)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]pyrimidine-2,4-dione (PubChem CID 7068480) has the molecular formula C20H25N4O3+ and a molecular weight of 369.45 g/mol. Its IUPAC name is 1-butyl-6-hydroxy-5-[(1R)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]pyrimidine-2,4-dione.
| Compound Name | 1-butyl-6-hydroxy-5-[(1R)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 7068480 |
| Molecular Formula | C20H25N4O3+ |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 1-butyl-6-hydroxy-5-[(1R)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]pyrimidine-2,4-dione |
| SMILES | CCCCn1c(O)c([C@@H]2c3[nH]c4ccccc4c3CC[NH+]2C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H24N4O3/c1-3-4-10-24-19(26)15(18(25)22-20(24)27)17-16-13(9-11-23(17)2)12-7-5-6-8-14(12)21-16/h5-8,17,21,26H,3-4,9-11H2,1-2H3,(H,22,25,27)/p+1/t17-/m1/s1 |
| InChIKey | UQTWXSLLUOGURL-QGZVFWFLSA-O |
| XLogP | 0.68 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|