C22H20FN4O3+ — CID 7068435
1-(4-fluorophenyl)-6-hydroxy-5-[(1R)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]pyrimidine-2,4-dione (PubChem CID 7068435) has the molecular formula C22H20FN4O3+ and a molecular weight of 407.43 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-6-hydroxy-5-[(1R)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]pyrimidine-2,4-dione.
| Compound Name | 1-(4-fluorophenyl)-6-hydroxy-5-[(1R)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 7068435 |
| Molecular Formula | C22H20FN4O3+ |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 1-(4-fluorophenyl)-6-hydroxy-5-[(1R)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]pyrimidine-2,4-dione |
| SMILES | C[NH+]1CCc2c([nH]c3ccccc23)[C@H]1c1c(O)n(-c2ccc(F)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H19FN4O3/c1-26-11-10-15-14-4-2-3-5-16(14)24-18(15)19(26)17-20(28)25-22(30)27(21(17)29)13-8-6-12(23)7-9-13/h2-9,19,24,29H,10-11H2,1H3,(H,25,28,30)/p+1/t19-/m1/s1 |
| InChIKey | URZQJFYOIYQCBR-LJQANCHMSA-O |
| XLogP | 1.01 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|