C24H25N4O3+ — CID 7068562
6-hydroxy-5-[(1S)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]-1-[(1S)-1-phenylethyl]pyrimidine-2,4-dione (PubChem CID 7068562) has the molecular formula C24H25N4O3+ and a molecular weight of 417.49 g/mol. Its IUPAC name is 6-hydroxy-5-[(1S)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]-1-[(1S)-1-phenylethyl]pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[(1S)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]-1-[(1S)-1-phenylethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 7068562 |
| Molecular Formula | C24H25N4O3+ |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 6-hydroxy-5-[(1S)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]-1-[(1S)-1-phenylethyl]pyrimidine-2,4-dione |
| SMILES | C[C@@H](c1ccccc1)n1c(O)c([C@H]2c3[nH]c4ccccc4c3CC[NH+]2C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H24N4O3/c1-14(15-8-4-3-5-9-15)28-23(30)19(22(29)26-24(28)31)21-20-17(12-13-27(21)2)16-10-6-7-11-18(16)25-20/h3-11,14,21,25,30H,12-13H2,1-2H3,(H,26,29,31)/p+1/t14-,21-/m0/s1 |
| InChIKey | GWWKHDLBANLUFC-QKKBWIMNSA-O |
| XLogP | 1.49 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|