C18H21N2O4+ — CID 7096872
6-hydroxy-2,2-dimethyl-5-[(1S)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]-1,3-dioxin-4-one (PubChem CID 7096872) has the molecular formula C18H21N2O4+ and a molecular weight of 329.38 g/mol. Its IUPAC name is 6-hydroxy-2,2-dimethyl-5-[(1S)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]-1,3-dioxin-4-one.
| Compound Name | 6-hydroxy-2,2-dimethyl-5-[(1S)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 7096872 |
| Molecular Formula | C18H21N2O4+ |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 6-hydroxy-2,2-dimethyl-5-[(1S)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]-1,3-dioxin-4-one |
| SMILES | C[NH+]1CCc2c([nH]c3ccccc23)[C@@H]1C1=C(O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C18H20N2O4/c1-18(2)23-16(21)13(17(22)24-18)15-14-11(8-9-20(15)3)10-6-4-5-7-12(10)19-14/h4-7,15,19,21H,8-9H2,1-3H3/p+1/t15-/m0/s1 |
| InChIKey | YACAEIDFENNALU-HNNXBMFYSA-O |
| XLogP | 1.36 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|